C19H15ClN2O6 — CID 22360863
(E)-4-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chloroanilino]-4-oxobut-2-enoic acid (PubChem CID 22360863) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is (E)-4-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chloroanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chloroanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22360863 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (E)-4-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chloroanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(Cl)cc1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15ClN2O6/c20-12-2-3-14(22-17(23)5-6-18(24)25)13(8-12)19(26)21-9-11-1-4-15-16(7-11)28-10-27-15/h1-8H,9-10H2,(H,21,26)(H,22,23)(H,24,25)/b6-5+ |
| InChIKey | CHKODEPSGCSUBZ-AATRIKPKSA-N |
| XLogP | 2.58 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|