C24H21ClN2O6 — CID 22360845
N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chlorophenyl]-2,5-dimethoxybenzamide (PubChem CID 22360845) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chlorophenyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chlorophenyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 22360845 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-4-chlorophenyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2ccc(Cl)cc2C(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H21ClN2O6/c1-30-16-5-8-20(31-2)18(11-16)24(29)27-19-6-4-15(25)10-17(19)23(28)26-12-14-3-7-21-22(9-14)33-13-32-21/h3-11H,12-13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | NSQWABXVELUVGA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |