C18H16ClNO6 — CID 142875458
[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-5-methoxyphenyl] 2-chloroacetate (PubChem CID 142875458) has the molecular formula C18H16ClNO6 and a molecular weight of 377.78 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-5-methoxyphenyl] 2-chloroacetate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-5-methoxyphenyl] 2-chloroacetate |
|---|---|
| PubChem CID | 142875458 |
| Molecular Formula | C18H16ClNO6 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-5-methoxyphenyl] 2-chloroacetate |
| SMILES | COc1ccc(C(=O)NCc2ccc3c(c2)OCO3)c(OC(=O)CCl)c1 |
| InChI | InChI=1S/C18H16ClNO6/c1-23-12-3-4-13(15(7-12)26-17(21)8-19)18(22)20-9-11-2-5-14-16(6-11)25-10-24-14/h2-7H,8-10H2,1H3,(H,20,22) |
| InChIKey | KCKXTSDTSGDAHI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|