C16H16ClNO2 — CID 2671578
5-chloro-2-methoxy-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 2671578) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 2671578 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H16ClNO2/c1-11-3-5-12(6-4-11)10-18-16(19)14-9-13(17)7-8-15(14)20-2/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | RYTPGBKJRWDWEK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |