C22H19ClFNO3 — CID 100529367
5-chloro-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methoxybenzamide (PubChem CID 100529367) has the molecular formula C22H19ClFNO3 and a molecular weight of 399.85 g/mol. Its IUPAC name is 5-chloro-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 100529367 |
| Molecular Formula | C22H19ClFNO3 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 5-chloro-N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H19ClFNO3/c1-27-21-11-6-17(23)12-20(21)22(26)25-13-15-4-9-19(10-5-15)28-14-16-2-7-18(24)8-3-16/h2-12H,13-14H2,1H3,(H,25,26) |
| InChIKey | QAZVXPCGHVXEKJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |