C26H28FNO3 — CID 100715760
N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-4-methoxy-2-methyl-5-propan-2-ylbenzamide (PubChem CID 100715760) has the molecular formula C26H28FNO3 and a molecular weight of 421.51 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-4-methoxy-2-methyl-5-propan-2-ylbenzamide.
| Compound Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-4-methoxy-2-methyl-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 100715760 |
| Molecular Formula | C26H28FNO3 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-4-methoxy-2-methyl-5-propan-2-ylbenzamide |
| SMILES | COc1cc(C)c(C(=O)NCc2ccc(OCc3ccc(F)cc3)cc2)cc1C(C)C |
| InChI | InChI=1S/C26H28FNO3/c1-17(2)23-14-24(18(3)13-25(23)30-4)26(29)28-15-19-7-11-22(12-8-19)31-16-20-5-9-21(27)10-6-20/h5-14,17H,15-16H2,1-4H3,(H,28,29) |
| InChIKey | UCIPNOZGNLYTCA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |