C22H20Cl2N4O3 — CID 108829026
(Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 108829026) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108829026 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(Cc2ccc3c(c2)OCO3)CC1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N4O3/c23-17-2-3-19(18(24)10-17)26-22(29)16(11-25)13-28-7-5-27(6-8-28)12-15-1-4-20-21(9-15)31-14-30-20/h1-4,9-10,13H,5-8,12,14H2,(H,26,29)/b16-13- |
| InChIKey | LLDFGMPUCGSJFY-SSZFMOIBSA-N |
| XLogP | 3.89 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|