C21H22N4O4 — CID 8721805
(E)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 8721805) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is (E)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 8721805 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C\N1CCN(Cc2ccc3c(c2)OCO3)CC1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H22N4O4/c22-11-17(21(26)23-12-18-2-1-9-27-18)14-25-7-5-24(6-8-25)13-16-3-4-19-20(10-16)29-15-28-19/h1-4,9-10,14H,5-8,12-13,15H2,(H,23,26)/b17-14+ |
| InChIKey | DYIBFZYYPHNIQJ-SAPNQHFASA-N |
| XLogP | 1.85 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|