C22H22N4O5S — CID 108841713
(Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide (PubChem CID 108841713) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108841713 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(S(=O)(=O)c2ccccc2)CC1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H22N4O5S/c23-13-18(22(27)24-14-17-6-7-20-21(12-17)31-16-30-20)15-25-8-10-26(11-9-25)32(28,29)19-4-2-1-3-5-19/h1-7,12,15H,8-11,14,16H2,(H,24,27)/b18-15- |
| InChIKey | KDCUMTKUOXHWPZ-SDXDJHTJSA-N |
| XLogP | 1.45 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|