C24H27ClN4O3 — CID 108841639
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride (PubChem CID 108841639) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 108841639 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)NCc3ccc4c(c3)OCO4)CC2)c1C.Cl |
| InChI | InChI=1S/C24H26N4O3.ClH/c1-17-4-3-5-21(18(17)2)28-10-8-27(9-11-28)15-20(13-25)24(29)26-14-19-6-7-22-23(12-19)31-16-30-22;/h3-7,12,15H,8-11,14,16H2,1-2H3,(H,26,29);1H/b20-15-; |
| InChIKey | INOMGIUKEPBQOD-CRDKNBMZSA-N |
| XLogP | 3.30 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|