C20H29ClN4O — CID 108834578
(Z)-N-butan-2-yl-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride (PubChem CID 108834578) has the molecular formula C20H29ClN4O and a molecular weight of 376.93 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride.
| Compound Name | (Z)-N-butan-2-yl-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 108834578 |
| Molecular Formula | C20H29ClN4O |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (Z)-N-butan-2-yl-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide;hydrochloride |
| SMILES | CCC(C)NC(=O)/C(C#N)=C\N1CCN(c2cccc(C)c2C)CC1.Cl |
| InChI | InChI=1S/C20H28N4O.ClH/c1-5-16(3)22-20(25)18(13-21)14-23-9-11-24(12-10-23)19-8-6-7-15(2)17(19)4;/h6-8,14,16H,5,9-12H2,1-4H3,(H,22,25);1H/b18-14-; |
| InChIKey | DKIAJWNTLBQMSV-NYAKATHWSA-N |
| XLogP | 3.17 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|