C23H25IN4O — CID 108860234
(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 108860234) has the molecular formula C23H25IN4O and a molecular weight of 500.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108860234 |
| Molecular Formula | C23H25IN4O |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(I)ccc1NC(=O)/C(C#N)=C\N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C23H25IN4O/c1-16-5-4-6-22(18(16)3)28-11-9-27(10-12-28)15-19(14-25)23(29)26-21-8-7-20(24)13-17(21)2/h4-8,13,15H,9-12H2,1-3H3,(H,26,29)/b19-15- |
| InChIKey | SPYRPPTUXGOKFZ-CYVLTUHYSA-N |
| XLogP | 4.38 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|