C16H18IN3O — CID 108860071
(Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-piperidin-1-ylprop-2-enamide (PubChem CID 108860071) has the molecular formula C16H18IN3O and a molecular weight of 395.24 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-piperidin-1-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-piperidin-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 108860071 |
| Molecular Formula | C16H18IN3O |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-piperidin-1-ylprop-2-enamide |
| SMILES | Cc1cc(I)ccc1NC(=O)/C(C#N)=C\N1CCCCC1 |
| InChI | InChI=1S/C16H18IN3O/c1-12-9-14(17)5-6-15(12)19-16(21)13(10-18)11-20-7-3-2-4-8-20/h5-6,9,11H,2-4,7-8H2,1H3,(H,19,21)/b13-11- |
| InChIKey | TWAABOMDTRPDFK-QBFSEMIESA-N |
| XLogP | 3.43 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|