C17H19IN4O2 — CID 108860014
(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 108860014) has the molecular formula C17H19IN4O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is (Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108860014 |
| Molecular Formula | C17H19IN4O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | CC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2ccc(I)cc2C)CC1 |
| InChI | InChI=1S/C17H19IN4O2/c1-12-9-15(18)3-4-16(12)20-17(24)14(10-19)11-21-5-7-22(8-6-21)13(2)23/h3-4,9,11H,5-8H2,1-2H3,(H,20,24)/b14-11- |
| InChIKey | PRHDRUWCUIJWDZ-KAMYIIQDSA-N |
| XLogP | 2.11 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|