C20H22N6O — CID 108857980
(Z)-2-cyano-N-(2,4-dimethylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide (PubChem CID 108857980) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dimethylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dimethylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108857980 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dimethylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\N2CCN(c3ncccn3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H22N6O/c1-15-4-5-18(16(2)12-15)24-19(27)17(13-21)14-25-8-10-26(11-9-25)20-22-6-3-7-23-20/h3-7,12,14H,8-11H2,1-2H3,(H,24,27)/b17-14- |
| InChIKey | RCFKLZRXQQFNRZ-VKAVYKQESA-N |
| XLogP | 2.26 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|