C18H19N7O3S — CID 108841993
(Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 108841993) has the molecular formula C18H19N7O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108841993 |
| Molecular Formula | C18H19N7O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2ncccn2)CC1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19N7O3S/c19-12-14(17(26)23-15-2-4-16(5-3-15)29(20,27)28)13-24-8-10-25(11-9-24)18-21-6-1-7-22-18/h1-7,13H,8-11H2,(H,23,26)(H2,20,27,28)/b14-13- |
| InChIKey | QGSBPDUDTSGGQG-YPKPFQOOSA-N |
| XLogP | 0.29 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|