C19H20N6O — CID 108821538
(Z)-2-cyano-N-(2-methylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide (PubChem CID 108821538) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108821538 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (Z)-2-cyano-N-(2-methylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H20N6O/c1-15-5-2-3-6-17(15)23-18(26)16(13-20)14-24-9-11-25(12-10-24)19-21-7-4-8-22-19/h2-8,14H,9-12H2,1H3,(H,23,26)/b16-14- |
| InChIKey | CCLKVHWQISBSHU-PEZBUJJGSA-N |
| XLogP | 1.95 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|