C20H22N6O2 — CID 108840880
(Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide (PubChem CID 108840880) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108840880 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (Z)-2-cyano-N-[(4-methoxyphenyl)methyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C(C#N)=C\N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-28-18-5-3-16(4-6-18)14-24-19(27)17(13-21)15-25-9-11-26(12-10-25)20-22-7-2-8-23-20/h2-8,15H,9-12,14H2,1H3,(H,24,27)/b17-15- |
| InChIKey | FWKQUHGCHYVQTN-ICFOKQHNSA-N |
| XLogP | 1.33 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|