C15H19ClN6O — CID 108854250
(Z)-N-(3-chloropropyl)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide (PubChem CID 108854250) has the molecular formula C15H19ClN6O and a molecular weight of 334.81 g/mol. Its IUPAC name is (Z)-N-(3-chloropropyl)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108854250 |
| Molecular Formula | C15H19ClN6O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2ncccn2)CC1)C(=O)NCCCCl |
| InChI | InChI=1S/C15H19ClN6O/c16-3-1-4-18-14(23)13(11-17)12-21-7-9-22(10-8-21)15-19-5-2-6-20-15/h2,5-6,12H,1,3-4,7-10H2,(H,18,23)/b13-12- |
| InChIKey | XAUJGYCPKJXEAV-SEYXRHQNSA-N |
| XLogP | 0.75 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|