C20H26N6O3 — CID 108831221
ethyl 1-[(Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831221) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is ethyl 1-[(Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831221 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | ethyl 1-[(Z)-2-cyano-3-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\N2CCN(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C20H26N6O3/c1-2-29-19(28)16-4-8-25(9-5-16)18(27)17(14-21)15-24-10-12-26(13-11-24)20-22-6-3-7-23-20/h3,6-7,15-16H,2,4-5,8-13H2,1H3/b17-15- |
| InChIKey | HOVRFYKMVLHOBI-ICFOKQHNSA-N |
| XLogP | 0.81 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|