C18H26N4O4 — CID 108831020
ethyl 1-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831020) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 1-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831020 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 1-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\N2CCN(C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C18H26N4O4/c1-3-26-18(25)15-4-6-22(7-5-15)17(24)16(12-19)13-20-8-10-21(11-9-20)14(2)23/h13,15H,3-11H2,1-2H3/b16-13- |
| InChIKey | PLFKHPLGQDYKDN-SSZFMOIBSA-N |
| XLogP | 0.36 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|