C17H25N3O5 — CID 108831032
2-[[(Z)-2-cyano-3-(4-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]amino]-3-methylbutanoic acid (PubChem CID 108831032) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(4-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(4-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 108831032 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(4-ethoxycarbonylpiperidin-1-yl)-3-oxoprop-1-enyl]amino]-3-methylbutanoic acid |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\NC(C(=O)O)C(C)C)CC1 |
| InChI | InChI=1S/C17H25N3O5/c1-4-25-17(24)12-5-7-20(8-6-12)15(21)13(9-18)10-19-14(11(2)3)16(22)23/h10-12,14,19H,4-8H2,1-3H3,(H,22,23)/b13-10- |
| InChIKey | FAGBCWPPVOHSNZ-RAXLEYEMSA-N |
| XLogP | 0.89 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|