C18H22N4O5S — CID 108831022
ethyl 1-[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831022) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 1-[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831022 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | ethyl 1-[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C18H22N4O5S/c1-2-27-18(24)13-7-9-22(10-8-13)17(23)14(11-19)12-21-15-3-5-16(6-4-15)28(20,25)26/h3-6,12-13,21H,2,7-10H2,1H3,(H2,20,25,26)/b14-12- |
| InChIKey | FYHCPZHXONWNJL-OWBHPGMISA-N |
| XLogP | 0.96 |
| TPSA | 142.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|