C12H13N3O4S — CID 41386505
ethyl (Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoate (PubChem CID 41386505) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoate |
|---|---|
| PubChem CID | 41386505 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | ethyl (Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S/c1-2-19-12(16)9(7-13)8-15-10-3-5-11(6-4-10)20(14,17)18/h3-6,8,15H,2H2,1H3,(H2,14,17,18)/b9-8- |
| InChIKey | VTXOOSYQVDFFAU-HJWRWDBZSA-N |
| XLogP | 0.72 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|