C15H19N3O4S — CID 19629006
methyl (Z)-2-cyano-3-[4-(diethylsulfamoyl)anilino]prop-2-enoate (PubChem CID 19629006) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl (Z)-2-cyano-3-[4-(diethylsulfamoyl)anilino]prop-2-enoate.
| Compound Name | methyl (Z)-2-cyano-3-[4-(diethylsulfamoyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 19629006 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl (Z)-2-cyano-3-[4-(diethylsulfamoyl)anilino]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)OC)cc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-4-18(5-2)23(20,21)14-8-6-13(7-9-14)17-11-12(10-16)15(19)22-3/h6-9,11,17H,4-5H2,1-3H3/b12-11- |
| InChIKey | RLLGKZFGSCLIJS-QXMHVHEDSA-N |
| XLogP | 1.71 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|