C15H19N3O5S — CID 8811884
ethyl (E)-2-cyano-3-[5-(dimethylsulfamoyl)-2-methoxyanilino]prop-2-enoate (PubChem CID 8811884) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[5-(dimethylsulfamoyl)-2-methoxyanilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[5-(dimethylsulfamoyl)-2-methoxyanilino]prop-2-enoate |
|---|---|
| PubChem CID | 8811884 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | ethyl (E)-2-cyano-3-[5-(dimethylsulfamoyl)-2-methoxyanilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cc(S(=O)(=O)N(C)C)ccc1OC |
| InChI | InChI=1S/C15H19N3O5S/c1-5-23-15(19)11(9-16)10-17-13-8-12(6-7-14(13)22-4)24(20,21)18(2)3/h6-8,10,17H,5H2,1-4H3/b11-10+ |
| InChIKey | OQOUTODVHPALJY-ZHACJKMWSA-N |
| XLogP | 1.33 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|