C19H19N3O6S — CID 7716966
[2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 7716966) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 7716966 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)COC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19N3O6S/c1-22(2)29(25,26)15-8-9-17(27-3)16(10-15)21-18(23)12-28-19(24)14-6-4-13(11-20)5-7-14/h4-10H,12H2,1-3H3,(H,21,23) |
| InChIKey | DDVJZBNZMPEGDS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |