C20H24N2O6S — CID 7364669
[2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-ethylbenzoate (PubChem CID 7364669) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-ethylbenzoate.
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 7364669 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-5-14-6-8-15(9-7-14)20(24)28-13-19(23)21-17-12-16(10-11-18(17)27-4)29(25,26)22(2)3/h6-12H,5,13H2,1-4H3,(H,21,23) |
| InChIKey | SSSSRJPRYSRXFL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |