C19H23N3O6S — CID 7670665
[2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 7670665) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7670665 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1OC |
| InChI | InChI=1S/C19H23N3O6S/c1-20-15-8-6-5-7-14(15)19(24)28-12-18(23)21-16-11-13(9-10-17(16)27-4)29(25,26)22(2)3/h5-11,20H,12H2,1-4H3,(H,21,23) |
| InChIKey | RNYJYESBPXTNCP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |