C19H23N3O6S — CID 7873856
2-(2-acetamidophenoxy)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide (PubChem CID 7873856) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-(2-acetamidophenoxy)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-(2-acetamidophenoxy)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 7873856 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(2-acetamidophenoxy)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)COc1ccccc1NC(C)=O |
| InChI | InChI=1S/C19H23N3O6S/c1-13(23)20-15-7-5-6-8-18(15)28-12-19(24)21-16-11-14(9-10-17(16)27-4)29(25,26)22(2)3/h5-11H,12H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | UOKHUNGGPWGWIE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |