C22H28N2O8S — CID 4234348
[2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 4234348) has the molecular formula C22H28N2O8S and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 4234348 |
| Molecular Formula | C22H28N2O8S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methoxyanilino]-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)OCC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C22H28N2O8S/c1-24(2)33(27,28)18-11-12-20(30-4)19(14-18)23-21(25)15-32-22(26)6-5-13-31-17-9-7-16(29-3)8-10-17/h7-12,14H,5-6,13,15H2,1-4H3,(H,23,25) |
| InChIKey | LZBNKJVXTXLGBP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|