C18H20N2O7S — CID 8943438
[2-(2-methoxyanilino)-2-oxoethyl] 4-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8943438) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 4-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8943438 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)c1ccc(S(=O)(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C18H20N2O7S/c1-20(26-3)28(23,24)14-10-8-13(9-11-14)18(22)27-12-17(21)19-15-6-4-5-7-16(15)25-2/h4-11H,12H2,1-3H3,(H,19,21) |
| InChIKey | YLNASFTWEOFDOU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|