C24H24N2O7S — CID 36698413
[2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 36698413) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 36698413 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccccc2Oc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H24N2O7S/c1-17-11-13-19(14-12-17)33-22-10-5-4-9-21(22)25-23(27)16-32-24(28)18-7-6-8-20(15-18)34(29,30)26(2)31-3/h4-15H,16H2,1-3H3,(H,25,27) |
| InChIKey | VNLAXLJCBUYMJR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|