C15H21NO7S — CID 35623092
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 35623092) has the molecular formula C15H21NO7S and a molecular weight of 359.40 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 35623092 |
| Molecular Formula | C15H21NO7S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H21NO7S/c1-15(2,3)23-13(17)10-22-14(18)11-7-6-8-12(9-11)24(19,20)16(4)21-5/h6-9H,10H2,1-5H3 |
| InChIKey | QJOOHQYXIFOWID-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|