tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate

C13H18FNO4S — CID 4658727

IUPACtert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate
SMILESCN(CC(=O)OC(C)(C)C)S(=O)(=O)c1cccc(F)c1
InChIInChI=1S/C13H18FNO4S/c1-13(2,3)19-12(16)9-15(4)20(17,18)11-7-5-6-10(14)8-11/h5-8H,9H2,1-4H3
InChIKeyLJQPVLWBTIWKKC-UHFFFAOYSA-N
MW303.35 g/mol
LogP1.79
Rot. Bonds4

About tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate

tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 4658727) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate.

Molecular Properties

Compound Nametert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate
PubChem CID4658727
Molecular FormulaC13H18FNO4S
Molecular Weight303.35 g/mol
Exact Mass303.09
IUPAC Nametert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate
SMILESCN(CC(=O)OC(C)(C)C)S(=O)(=O)c1cccc(F)c1
InChIInChI=1S/C13H18FNO4S/c1-13(2,3)19-12(16)9-15(4)20(17,18)11-7-5-6-10(14)8-11/h5-8H,9H2,1-4H3
InChIKeyLJQPVLWBTIWKKC-UHFFFAOYSA-N
XLogP1.79
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.35
LogP ≤ 51.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate?
The IUPAC name of tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate (CID 4658727) is tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate.
What is the SMILES notation for tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate?
The canonical SMILES for tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate is CN(CC(=O)OC(C)(C)C)S(=O)(=O)c1cccc(F)c1.
What is the InChIKey of tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate?
The InChIKey is LJQPVLWBTIWKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO4S/c1-13(2,3)19-12(16)9-15(4)20(17,18)11-7-5-6-10(14)8-11/h5-8H,9H2,1-4H3.
What are the key properties of tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate?
tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate has a molecular weight of 303.35 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate is sourced from PubChem (CID 4658727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).