C13H18FNO4S — CID 4658727
tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 4658727) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 4658727 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | tert-butyl 2-[(3-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H18FNO4S/c1-13(2,3)19-12(16)9-15(4)20(17,18)11-7-5-6-10(14)8-11/h5-8H,9H2,1-4H3 |
| InChIKey | LJQPVLWBTIWKKC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |