C17H27NO4S — CID 3390799
tert-butyl 2-[tert-butyl-(3-methylphenyl)sulfonylamino]acetate (PubChem CID 3390799) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl-(3-methylphenyl)sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[tert-butyl-(3-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 3390799 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl 2-[tert-butyl-(3-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1cccc(S(=O)(=O)N(CC(=O)OC(C)(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO4S/c1-13-9-8-10-14(11-13)23(20,21)18(16(2,3)4)12-15(19)22-17(5,6)7/h8-11H,12H2,1-7H3 |
| InChIKey | MTNVXSYMEGVUQO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |