About tert-butyl 3-methylbenzenesulfonate
tert-butyl 3-methylbenzenesulfonate (PubChem CID 22436753) has the molecular formula C11H16O3S
and a molecular weight of 228.31 g/mol. Its IUPAC name is tert-butyl 3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | tert-butyl 3-methylbenzenesulfonate |
| PubChem CID | 22436753 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | tert-butyl 3-methylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C11H16O3S/c1-9-6-5-7-10(8-9)15(12,13)14-11(2,3)4/h5-8H,1-4H3 |
| InChIKey | JXXNZESQFWEABX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methylbenzenesulfonate?
The IUPAC name of tert-butyl 3-methylbenzenesulfonate (CID 22436753) is tert-butyl 3-methylbenzenesulfonate.
What is the SMILES notation for tert-butyl 3-methylbenzenesulfonate?
The canonical SMILES for tert-butyl 3-methylbenzenesulfonate is Cc1cccc(S(=O)(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 3-methylbenzenesulfonate?
The InChIKey is JXXNZESQFWEABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3S/c1-9-6-5-7-10(8-9)15(12,13)14-11(2,3)4/h5-8H,1-4H3.
What are the key properties of tert-butyl 3-methylbenzenesulfonate?
tert-butyl 3-methylbenzenesulfonate has a molecular weight of 228.31 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methylbenzenesulfonate is sourced from PubChem (CID 22436753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).