About anilino 3-methylbenzenesulfonate
anilino 3-methylbenzenesulfonate (PubChem CID 54430055) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is anilino 3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | anilino 3-methylbenzenesulfonate |
| PubChem CID | 54430055 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | anilino 3-methylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)ONc2ccccc2)c1 |
| InChI | InChI=1S/C13H13NO3S/c1-11-6-5-9-13(10-11)18(15,16)17-14-12-7-3-2-4-8-12/h2-10,14H,1H3 |
| InChIKey | WGVROACIMIRPAT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilino 3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino 3-methylbenzenesulfonate?
The IUPAC name of anilino 3-methylbenzenesulfonate (CID 54430055) is anilino 3-methylbenzenesulfonate.
What is the SMILES notation for anilino 3-methylbenzenesulfonate?
The canonical SMILES for anilino 3-methylbenzenesulfonate is Cc1cccc(S(=O)(=O)ONc2ccccc2)c1.
What is the InChIKey of anilino 3-methylbenzenesulfonate?
The InChIKey is WGVROACIMIRPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-11-6-5-9-13(10-11)18(15,16)17-14-12-7-3-2-4-8-12/h2-10,14H,1H3.
What are the key properties of anilino 3-methylbenzenesulfonate?
anilino 3-methylbenzenesulfonate has a molecular weight of 263.32 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anilino 3-methylbenzenesulfonate is sourced from PubChem (CID 54430055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).