C21H20N2O6S2 — CID 91111235
[[(4-methylphenyl)sulfonyl-phenylcarbamoyl]amino] 3-methylbenzenesulfonate (PubChem CID 91111235) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is [[(4-methylphenyl)sulfonyl-phenylcarbamoyl]amino] 3-methylbenzenesulfonate.
| Compound Name | [[(4-methylphenyl)sulfonyl-phenylcarbamoyl]amino] 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91111235 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [[(4-methylphenyl)sulfonyl-phenylcarbamoyl]amino] 3-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)NOS(=O)(=O)c2cccc(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O6S2/c1-16-11-13-19(14-12-16)30(25,26)23(18-8-4-3-5-9-18)21(24)22-29-31(27,28)20-10-6-7-17(2)15-20/h3-15H,1-2H3,(H,22,24) |
| InChIKey | GBEQAWUPPBXBBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|