About anilino 4-nitrobenzenesulfonate
anilino 4-nitrobenzenesulfonate (PubChem CID 24975818) has the molecular formula C12H10N2O5S
and a molecular weight of 294.29 g/mol. Its IUPAC name is anilino 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | anilino 4-nitrobenzenesulfonate |
| PubChem CID | 24975818 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | anilino 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)ONc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2O5S/c15-14(16)11-6-8-12(9-7-11)20(17,18)19-13-10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | LOOSYKZZZOTIIK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilino 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino 4-nitrobenzenesulfonate?
The IUPAC name of anilino 4-nitrobenzenesulfonate (CID 24975818) is anilino 4-nitrobenzenesulfonate.
What is the SMILES notation for anilino 4-nitrobenzenesulfonate?
The canonical SMILES for anilino 4-nitrobenzenesulfonate is O=[N+]([O-])c1ccc(S(=O)(=O)ONc2ccccc2)cc1.
What is the InChIKey of anilino 4-nitrobenzenesulfonate?
The InChIKey is LOOSYKZZZOTIIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O5S/c15-14(16)11-6-8-12(9-7-11)20(17,18)19-13-10-4-2-1-3-5-10/h1-9,13H.
What are the key properties of anilino 4-nitrobenzenesulfonate?
anilino 4-nitrobenzenesulfonate has a molecular weight of 294.29 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for anilino 4-nitrobenzenesulfonate is sourced from PubChem (CID 24975818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).