About nitrobenzene;sulfamide
nitrobenzene;sulfamide (PubChem CID 19382092) has the molecular formula C6H9N3O4S
and a molecular weight of 219.22 g/mol. Its IUPAC name is nitrobenzene;sulfamide.
Molecular Properties
| Compound Name | nitrobenzene;sulfamide |
| PubChem CID | 19382092 |
| Molecular Formula | C6H9N3O4S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | nitrobenzene;sulfamide |
| SMILES | NS(N)(=O)=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.H4N2O2S/c8-7(9)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;(H4,1,2,3,4) |
| InChIKey | YYRPZPMQVQAALO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;sulfamide?
The IUPAC name of nitrobenzene;sulfamide (CID 19382092) is nitrobenzene;sulfamide.
What is the SMILES notation for nitrobenzene;sulfamide?
The canonical SMILES for nitrobenzene;sulfamide is NS(N)(=O)=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene;sulfamide?
The InChIKey is YYRPZPMQVQAALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.H4N2O2S/c8-7(9)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;(H4,1,2,3,4).
What are the key properties of nitrobenzene;sulfamide?
nitrobenzene;sulfamide has a molecular weight of 219.22 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;sulfamide is sourced from PubChem (CID 19382092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).