About methane;nitrobenzene;sulfuryl dichloride
methane;nitrobenzene;sulfuryl dichloride (PubChem CID 174890288) has the molecular formula C7H9Cl2NO4S
and a molecular weight of 274.12 g/mol. Its IUPAC name is methane;nitrobenzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | methane;nitrobenzene;sulfuryl dichloride |
| PubChem CID | 174890288 |
| Molecular Formula | C7H9Cl2NO4S |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | methane;nitrobenzene;sulfuryl dichloride |
| SMILES | C.O=S(=O)(Cl)Cl.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.CH4.Cl2O2S/c8-7(9)6-4-2-1-3-5-6;;1-5(2,3)4/h1-5H;1H4; |
| InChIKey | DLQTUFCUHDVBFL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;nitrobenzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;nitrobenzene;sulfuryl dichloride?
The IUPAC name of methane;nitrobenzene;sulfuryl dichloride (CID 174890288) is methane;nitrobenzene;sulfuryl dichloride.
What is the SMILES notation for methane;nitrobenzene;sulfuryl dichloride?
The canonical SMILES for methane;nitrobenzene;sulfuryl dichloride is C.O=S(=O)(Cl)Cl.O=[N+]([O-])c1ccccc1.
What is the InChIKey of methane;nitrobenzene;sulfuryl dichloride?
The InChIKey is DLQTUFCUHDVBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CH4.Cl2O2S/c8-7(9)6-4-2-1-3-5-6;;1-5(2,3)4/h1-5H;1H4;.
What are the key properties of methane;nitrobenzene;sulfuryl dichloride?
methane;nitrobenzene;sulfuryl dichloride has a molecular weight of 274.12 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;nitrobenzene;sulfuryl dichloride is sourced from PubChem (CID 174890288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).