C24H15N3O15S3 — CID 19421191
[3,5-bis[(4-nitrophenyl)sulfonyloxy]phenyl] 4-nitrobenzenesulfonate (PubChem CID 19421191) has the molecular formula C24H15N3O15S3 and a molecular weight of 681.59 g/mol. Its IUPAC name is [3,5-bis[(4-nitrophenyl)sulfonyloxy]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [3,5-bis[(4-nitrophenyl)sulfonyloxy]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 19421191 |
| Molecular Formula | C24H15N3O15S3 |
| Molecular Weight | 681.59 g/mol |
| Exact Mass | 680.97 |
| IUPAC Name | [3,5-bis[(4-nitrophenyl)sulfonyloxy]phenyl] 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Oc2cc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C24H15N3O15S3/c28-25(29)16-1-7-22(8-2-16)43(34,35)40-19-13-20(41-44(36,37)23-9-3-17(4-10-23)26(30)31)15-21(14-19)42-45(38,39)24-11-5-18(6-12-24)27(32)33/h1-15H |
| InChIKey | HSNYPUDPHLFQRX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 259.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|