C12H4F5NO5S — CID 172838791
(4-nitrophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 172838791) has the molecular formula C12H4F5NO5S and a molecular weight of 369.22 g/mol. Its IUPAC name is (4-nitrophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (4-nitrophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 172838791 |
| Molecular Formula | C12H4F5NO5S |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | (4-nitrophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C12H4F5NO5S/c13-7-8(14)10(16)12(11(17)9(7)15)24(21,22)23-6-3-1-5(2-4-6)18(19)20/h1-4H |
| InChIKey | WNBCLADKVWURLT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|