C12H4F5NO4 — CID 90992446
1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)peroxybenzene (PubChem CID 90992446) has the molecular formula C12H4F5NO4 and a molecular weight of 321.16 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)peroxybenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)peroxybenzene |
|---|---|
| PubChem CID | 90992446 |
| Molecular Formula | C12H4F5NO4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)peroxybenzene |
| SMILES | O=[N+]([O-])c1ccc(OOc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C12H4F5NO4/c13-7-8(14)10(16)12(11(17)9(7)15)22-21-6-3-1-5(2-4-6)18(19)20/h1-4H |
| InChIKey | NNDAWCCIYZMTTO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|