C8H6ClF2NO3 — CID 134985893
1-(2-chloro-2,2-difluoroethoxy)-4-nitrobenzene (PubChem CID 134985893) has the molecular formula C8H6ClF2NO3 and a molecular weight of 237.59 g/mol. Its IUPAC name is 1-(2-chloro-2,2-difluoroethoxy)-4-nitrobenzene.
| Compound Name | 1-(2-chloro-2,2-difluoroethoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 134985893 |
| Molecular Formula | C8H6ClF2NO3 |
| Molecular Weight | 237.59 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 1-(2-chloro-2,2-difluoroethoxy)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OCC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C8H6ClF2NO3/c9-8(10,11)5-15-7-3-1-6(2-4-7)12(13)14/h1-4H,5H2 |
| InChIKey | KAAKENDDAWPIMV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|