C8H4ClF4NO3 — CID 12030755
1-(2-chloro-1,1,2,2-tetrafluoroethoxy)-4-nitrobenzene (PubChem CID 12030755) has the molecular formula C8H4ClF4NO3 and a molecular weight of 273.57 g/mol. Its IUPAC name is 1-(2-chloro-1,1,2,2-tetrafluoroethoxy)-4-nitrobenzene.
| Compound Name | 1-(2-chloro-1,1,2,2-tetrafluoroethoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 12030755 |
| Molecular Formula | C8H4ClF4NO3 |
| Molecular Weight | 273.57 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 1-(2-chloro-1,1,2,2-tetrafluoroethoxy)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OC(F)(F)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C8H4ClF4NO3/c9-7(10,11)8(12,13)17-6-3-1-5(2-4-6)14(15)16/h1-4H |
| InChIKey | YVUAXQWZLSALRC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|