C8H4F5NO3S — CID 171061621
1-nitro-4-(1,1,2,2,2-pentafluoroethoxysulfanyl)benzene (PubChem CID 171061621) has the molecular formula C8H4F5NO3S and a molecular weight of 289.18 g/mol. Its IUPAC name is 1-nitro-4-(1,1,2,2,2-pentafluoroethoxysulfanyl)benzene.
| Compound Name | 1-nitro-4-(1,1,2,2,2-pentafluoroethoxysulfanyl)benzene |
|---|---|
| PubChem CID | 171061621 |
| Molecular Formula | C8H4F5NO3S |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 1-nitro-4-(1,1,2,2,2-pentafluoroethoxysulfanyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(SOC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H4F5NO3S/c9-7(10,11)8(12,13)17-18-6-3-1-5(2-4-6)14(15)16/h1-4H |
| InChIKey | YBFPGSNDVODNHG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|