C39H24F6N2O4S2 — CID 175344107
1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfanylphenyl]phenyl]propan-2-yl]-4-[4-(4-nitrophenyl)sulfanylphenyl]benzene (PubChem CID 175344107) has the molecular formula C39H24F6N2O4S2 and a molecular weight of 762.75 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfanylphenyl]phenyl]propan-2-yl]-4-[4-(4-nitrophenyl)sulfanylphenyl]benzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfanylphenyl]phenyl]propan-2-yl]-4-[4-(4-nitrophenyl)sulfanylphenyl]benzene |
|---|---|
| PubChem CID | 175344107 |
| Molecular Formula | C39H24F6N2O4S2 |
| Molecular Weight | 762.75 g/mol |
| Exact Mass | 762.11 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfanylphenyl]phenyl]propan-2-yl]-4-[4-(4-nitrophenyl)sulfanylphenyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc(-c3ccc(C(c4ccc(-c5ccc(Sc6ccc([N+](=O)[O-])cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H24F6N2O4S2/c40-38(41,42)37(39(43,44)45,29-9-1-25(2-10-29)27-5-17-33(18-6-27)52-35-21-13-31(14-22-35)46(48)49)30-11-3-26(4-12-30)28-7-19-34(20-8-28)53-36-23-15-32(16-24-36)47(50)51/h1-24H |
| InChIKey | BMIHYMWIEQBMEY-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.75 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|