C12H4F5NO2S — CID 4829641
1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)sulfanylbenzene (PubChem CID 4829641) has the molecular formula C12H4F5NO2S and a molecular weight of 321.23 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)sulfanylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 4829641 |
| Molecular Formula | C12H4F5NO2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(4-nitrophenyl)sulfanylbenzene |
| SMILES | O=[N+]([O-])c1ccc(Sc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C12H4F5NO2S/c13-7-8(14)10(16)12(11(17)9(7)15)21-6-3-1-5(2-4-6)18(19)20/h1-4H |
| InChIKey | IQMFORSKNCMPBZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|